C22H27N5O2 — CID 170043057
7-[[4-(4-amino-2-methoxyphenyl)piperazin-1-yl]methyl]-3-ethyl-1H-1,5-naphthyridin-2-one (PubChem CID 170043057) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 7-[[4-(4-amino-2-methoxyphenyl)piperazin-1-yl]methyl]-3-ethyl-1H-1,5-naphthyridin-2-one.
| Compound Name | 7-[[4-(4-amino-2-methoxyphenyl)piperazin-1-yl]methyl]-3-ethyl-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 170043057 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 7-[[4-(4-amino-2-methoxyphenyl)piperazin-1-yl]methyl]-3-ethyl-1H-1,5-naphthyridin-2-one |
| SMILES | CCc1cc2ncc(CN3CCN(c4ccc(N)cc4OC)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C22H27N5O2/c1-3-16-11-18-19(25-22(16)28)10-15(13-24-18)14-26-6-8-27(9-7-26)20-5-4-17(23)12-21(20)29-2/h4-5,10-13H,3,6-9,14,23H2,1-2H3,(H,25,28) |
| InChIKey | SSKKCHDACWMJDU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|