C19H24N4OS — CID 177022356
7-[[4-(cyclopropanecarbothioyl)piperazin-1-yl]methyl]-3-ethyl-1H-1,5-naphthyridin-2-one (PubChem CID 177022356) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 7-[[4-(cyclopropanecarbothioyl)piperazin-1-yl]methyl]-3-ethyl-1H-1,5-naphthyridin-2-one.
| Compound Name | 7-[[4-(cyclopropanecarbothioyl)piperazin-1-yl]methyl]-3-ethyl-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 177022356 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 7-[[4-(cyclopropanecarbothioyl)piperazin-1-yl]methyl]-3-ethyl-1H-1,5-naphthyridin-2-one |
| SMILES | CCc1cc2ncc(CN3CCN(C(=S)C4CC4)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C19H24N4OS/c1-2-14-10-16-17(21-18(14)24)9-13(11-20-16)12-22-5-7-23(8-6-22)19(25)15-3-4-15/h9-11,15H,2-8,12H2,1H3,(H,21,24) |
| InChIKey | JBTZMZUCPCXZFS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|