C11H15N5 — CID 83887715
5-(piperazin-1-ylmethyl)triazolo[1,5-a]pyridine (PubChem CID 83887715) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 5-(piperazin-1-ylmethyl)triazolo[1,5-a]pyridine.
| Compound Name | 5-(piperazin-1-ylmethyl)triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 83887715 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 5-(piperazin-1-ylmethyl)triazolo[1,5-a]pyridine |
| SMILES | c1cn2nncc2cc1CN1CCNCC1 |
| InChI | InChI=1S/C11H15N5/c1-4-16-11(8-13-14-16)7-10(1)9-15-5-2-12-3-6-15/h1,4,7-8,12H,2-3,5-6,9H2 |
| InChIKey | ROFVQQXHDYKSBA-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |