C10H17N3 — CID 82280746
1-[(1-methylpyrrol-3-yl)methyl]piperazine (PubChem CID 82280746) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-[(1-methylpyrrol-3-yl)methyl]piperazine.
| Compound Name | 1-[(1-methylpyrrol-3-yl)methyl]piperazine |
|---|---|
| PubChem CID | 82280746 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-[(1-methylpyrrol-3-yl)methyl]piperazine |
| SMILES | Cn1ccc(CN2CCNCC2)c1 |
| InChI | InChI=1S/C10H17N3/c1-12-5-2-10(8-12)9-13-6-3-11-4-7-13/h2,5,8,11H,3-4,6-7,9H2,1H3 |
| InChIKey | BIHVRQZCGWIRSS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |