C12H15ClN4 — CID 117380176
3-chloro-6-(piperazin-1-ylmethyl)-2H-indazole (PubChem CID 117380176) has the molecular formula C12H15ClN4 and a molecular weight of 250.73 g/mol. Its IUPAC name is 3-chloro-6-(piperazin-1-ylmethyl)-2H-indazole.
| Compound Name | 3-chloro-6-(piperazin-1-ylmethyl)-2H-indazole |
|---|---|
| PubChem CID | 117380176 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-chloro-6-(piperazin-1-ylmethyl)-2H-indazole |
| SMILES | Clc1[nH]nc2cc(CN3CCNCC3)ccc12 |
| InChI | InChI=1S/C12H15ClN4/c13-12-10-2-1-9(7-11(10)15-16-12)8-17-5-3-14-4-6-17/h1-2,7,14H,3-6,8H2,(H,15,16) |
| InChIKey | RMXHXVFQRDUJIF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |