C27H32N4O3 — CID 177174261
N-cyclopropyl-1-[7-methoxy-2-[4-[2-(methylamino)ethoxy]phenyl]quinolin-4-yl]pyrrolidine-3-carboxamide (PubChem CID 177174261) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-cyclopropyl-1-[7-methoxy-2-[4-[2-(methylamino)ethoxy]phenyl]quinolin-4-yl]pyrrolidine-3-carboxamide.
| Compound Name | N-cyclopropyl-1-[7-methoxy-2-[4-[2-(methylamino)ethoxy]phenyl]quinolin-4-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 177174261 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N-cyclopropyl-1-[7-methoxy-2-[4-[2-(methylamino)ethoxy]phenyl]quinolin-4-yl]pyrrolidine-3-carboxamide |
| SMILES | CNCCOc1ccc(-c2cc(N3CCC(C(=O)NC4CC4)C3)c3ccc(OC)cc3n2)cc1 |
| InChI | InChI=1S/C27H32N4O3/c1-28-12-14-34-21-7-3-18(4-8-21)24-16-26(23-10-9-22(33-2)15-25(23)30-24)31-13-11-19(17-31)27(32)29-20-5-6-20/h3-4,7-10,15-16,19-20,28H,5-6,11-14,17H2,1-2H3,(H,29,32) |
| InChIKey | QKSGGXGMBQGNOC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|