C27H32N4O3 — CID 177173741
2-[7-methoxy-2-[4-[3-(methylamino)propoxy]phenyl]quinolin-4-yl]-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one (PubChem CID 177173741) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-[7-methoxy-2-[4-[3-(methylamino)propoxy]phenyl]quinolin-4-yl]-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one.
| Compound Name | 2-[7-methoxy-2-[4-[3-(methylamino)propoxy]phenyl]quinolin-4-yl]-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 177173741 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 2-[7-methoxy-2-[4-[3-(methylamino)propoxy]phenyl]quinolin-4-yl]-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one |
| SMILES | CNCCCOc1ccc(-c2cc(N3CC4CCNC(=O)C4C3)c3ccc(OC)cc3n2)cc1 |
| InChI | InChI=1S/C27H32N4O3/c1-28-11-3-13-34-20-6-4-18(5-7-20)24-15-26(22-9-8-21(33-2)14-25(22)30-24)31-16-19-10-12-29-27(32)23(19)17-31/h4-9,14-15,19,23,28H,3,10-13,16-17H2,1-2H3,(H,29,32) |
| InChIKey | XNOJJNQJIBQVAP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|