C27H36FN3O3 — CID 177173416
2-[4-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-6-fluoro-7-methoxyquinolin-2-yl]phenoxy]-N-methylethanamine;ethane;molecular hydrogen (PubChem CID 177173416) has the molecular formula C27H36FN3O3 and a molecular weight of 469.60 g/mol. Its IUPAC name is 2-[4-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-6-fluoro-7-methoxyquinolin-2-yl]phenoxy]-N-methylethanamine;ethane;molecular hydrogen.
| Compound Name | 2-[4-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-6-fluoro-7-methoxyquinolin-2-yl]phenoxy]-N-methylethanamine;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 177173416 |
| Molecular Formula | C27H36FN3O3 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2-[4-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-6-fluoro-7-methoxyquinolin-2-yl]phenoxy]-N-methylethanamine;ethane;molecular hydrogen |
| SMILES | CC.CNCCOc1ccc(-c2cc(N3CC4COCC4C3)c3cc(F)c(OC)cc3n2)cc1.[H][H] |
| InChI | InChI=1S/C25H28FN3O3.C2H6.H2/c1-27-7-8-32-19-5-3-16(4-6-19)22-10-24(29-12-17-14-31-15-18(17)13-29)20-9-21(26)25(30-2)11-23(20)28-22;1-2;/h3-6,9-11,17-18,27H,7-8,12-15H2,1-2H3;1-2H3;1H |
| InChIKey | HHDGMUNPQVUBJI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|