C32H37FN4O5 — CID 177173156
tert-butyl 3-[4-[4-[(3aS,7aR)-4-oxo-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-fluoro-7-methoxyquinolin-2-yl]phenoxy]pyrrolidine-1-carboxylate (PubChem CID 177173156) has the molecular formula C32H37FN4O5 and a molecular weight of 576.67 g/mol. Its IUPAC name is tert-butyl 3-[4-[4-[(3aS,7aR)-4-oxo-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-fluoro-7-methoxyquinolin-2-yl]phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[4-[(3aS,7aR)-4-oxo-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-fluoro-7-methoxyquinolin-2-yl]phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177173156 |
| Molecular Formula | C32H37FN4O5 |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | tert-butyl 3-[4-[4-[(3aS,7aR)-4-oxo-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-fluoro-7-methoxyquinolin-2-yl]phenoxy]pyrrolidine-1-carboxylate |
| SMILES | COc1cc2nc(-c3ccc(OC4CCN(C(=O)OC(C)(C)C)C4)cc3)cc(N3C[C@@H]4CCNC(=O)[C@@H]4C3)c2cc1F |
| InChI | InChI=1S/C32H37FN4O5/c1-32(2,3)42-31(39)36-12-10-22(17-36)41-21-7-5-19(6-8-21)26-14-28(23-13-25(33)29(40-4)15-27(23)35-26)37-16-20-9-11-34-30(38)24(20)18-37/h5-8,13-15,20,22,24H,9-12,16-18H2,1-4H3,(H,34,38)/t20-,22?,24+/m0/s1 |
| InChIKey | NYGYJJLVOLSEMQ-BRGACJNDSA-N |
| XLogP | 5.01 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |