C25H30N4O4 — CID 177173899
[1-[7-methoxy-2-[4-[2-(methylamino)ethoxy]phenyl]quinolin-4-yl]pyrrolidin-3-yl] N-methylcarbamate (PubChem CID 177173899) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is [1-[7-methoxy-2-[4-[2-(methylamino)ethoxy]phenyl]quinolin-4-yl]pyrrolidin-3-yl] N-methylcarbamate.
| Compound Name | [1-[7-methoxy-2-[4-[2-(methylamino)ethoxy]phenyl]quinolin-4-yl]pyrrolidin-3-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 177173899 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [1-[7-methoxy-2-[4-[2-(methylamino)ethoxy]phenyl]quinolin-4-yl]pyrrolidin-3-yl] N-methylcarbamate |
| SMILES | CNCCOc1ccc(-c2cc(N3CCC(OC(=O)NC)C3)c3ccc(OC)cc3n2)cc1 |
| InChI | InChI=1S/C25H30N4O4/c1-26-11-13-32-18-6-4-17(5-7-18)22-15-24(21-9-8-19(31-3)14-23(21)28-22)29-12-10-20(16-29)33-25(30)27-2/h4-9,14-15,20,26H,10-13,16H2,1-3H3,(H,27,30) |
| InChIKey | MSAVZIBIVQMEGH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|