C22H27N3O3S — CID 177173042
[1-[2-methoxy-5-[4-[2-(methylamino)ethoxy]phenyl]thieno[3,2-b]pyridin-7-yl]pyrrolidin-3-yl]methanol (PubChem CID 177173042) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is [1-[2-methoxy-5-[4-[2-(methylamino)ethoxy]phenyl]thieno[3,2-b]pyridin-7-yl]pyrrolidin-3-yl]methanol.
| Compound Name | [1-[2-methoxy-5-[4-[2-(methylamino)ethoxy]phenyl]thieno[3,2-b]pyridin-7-yl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 177173042 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | [1-[2-methoxy-5-[4-[2-(methylamino)ethoxy]phenyl]thieno[3,2-b]pyridin-7-yl]pyrrolidin-3-yl]methanol |
| SMILES | CNCCOc1ccc(-c2cc(N3CCC(CO)C3)c3sc(OC)cc3n2)cc1 |
| InChI | InChI=1S/C22H27N3O3S/c1-23-8-10-28-17-5-3-16(4-6-17)18-11-20(25-9-7-15(13-25)14-26)22-19(24-18)12-21(27-2)29-22/h3-6,11-12,15,23,26H,7-10,13-14H2,1-2H3 |
| InChIKey | QBHPVXSJVAOXRA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|