C29H37N5O3 — CID 177173621
2-[4-[4-[(3aR,7aR)-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-7-(dimethylamino)quinolin-2-yl]phenoxy]ethyl N-methylcarbamate (PubChem CID 177173621) has the molecular formula C29H37N5O3 and a molecular weight of 503.65 g/mol. Its IUPAC name is 2-[4-[4-[(3aR,7aR)-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-7-(dimethylamino)quinolin-2-yl]phenoxy]ethyl N-methylcarbamate.
| Compound Name | 2-[4-[4-[(3aR,7aR)-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-7-(dimethylamino)quinolin-2-yl]phenoxy]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 177173621 |
| Molecular Formula | C29H37N5O3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | 2-[4-[4-[(3aR,7aR)-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-7-(dimethylamino)quinolin-2-yl]phenoxy]ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCOc1ccc(-c2cc(N3C[C@H]4CN(C)CC[C@H]4C3)c3ccc(N(C)C)cc3n2)cc1 |
| InChI | InChI=1S/C29H37N5O3/c1-30-29(35)37-14-13-36-24-8-5-20(6-9-24)26-16-28(25-10-7-23(32(2)3)15-27(25)31-26)34-18-21-11-12-33(4)17-22(21)19-34/h5-10,15-16,21-22H,11-14,17-19H2,1-4H3,(H,30,35)/t21-,22+/m0/s1 |
| InChIKey | ZZDNXBZJYMNQIR-FCHUYYIVSA-N |
| XLogP | 4.09 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|