C26H30FN5O4 — CID 146530799
7-fluoro-3-methyl-8-[6-[3-(oxan-2-yloxy)propoxy]-3-pyridinyl]-1-propan-2-ylimidazo[4,5-c]cinnolin-2-one (PubChem CID 146530799) has the molecular formula C26H30FN5O4 and a molecular weight of 495.56 g/mol. Its IUPAC name is 7-fluoro-3-methyl-8-[6-[3-(oxan-2-yloxy)propoxy]-3-pyridinyl]-1-propan-2-ylimidazo[4,5-c]cinnolin-2-one.
| Compound Name | 7-fluoro-3-methyl-8-[6-[3-(oxan-2-yloxy)propoxy]-3-pyridinyl]-1-propan-2-ylimidazo[4,5-c]cinnolin-2-one |
|---|---|
| PubChem CID | 146530799 |
| Molecular Formula | C26H30FN5O4 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 7-fluoro-3-methyl-8-[6-[3-(oxan-2-yloxy)propoxy]-3-pyridinyl]-1-propan-2-ylimidazo[4,5-c]cinnolin-2-one |
| SMILES | CC(C)n1c(=O)n(C)c2nnc3cc(F)c(-c4ccc(OCCCOC5CCCCO5)nc4)cc3c21 |
| InChI | InChI=1S/C26H30FN5O4/c1-16(2)32-24-19-13-18(20(27)14-21(19)29-30-25(24)31(3)26(32)33)17-8-9-22(28-15-17)34-11-6-12-36-23-7-4-5-10-35-23/h8-9,13-16,23H,4-7,10-12H2,1-3H3 |
| InChIKey | YRVKUJGMOOCDOW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 93.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|