C14H20N4O5S — CID 118500606
(2S)-N-tert-butyl-2-(2,6-dinitroanilino)-3-methylsulfanylpropanamide (PubChem CID 118500606) has the molecular formula C14H20N4O5S and a molecular weight of 356.40 g/mol. Its IUPAC name is (2S)-N-tert-butyl-2-(2,6-dinitroanilino)-3-methylsulfanylpropanamide.
| Compound Name | (2S)-N-tert-butyl-2-(2,6-dinitroanilino)-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 118500606 |
| Molecular Formula | C14H20N4O5S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (2S)-N-tert-butyl-2-(2,6-dinitroanilino)-3-methylsulfanylpropanamide |
| SMILES | CSC[C@@H](Nc1c([N+](=O)[O-])cccc1[N+](=O)[O-])C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H20N4O5S/c1-14(2,3)16-13(19)9(8-24-4)15-12-10(17(20)21)6-5-7-11(12)18(22)23/h5-7,9,15H,8H2,1-4H3,(H,16,19)/t9-/m1/s1 |
| InChIKey | FGWMGELVURBRCC-SECBINFHSA-N |
| XLogP | 2.56 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|