C20H22N6O9S — CID 88957986
2-(2,6-dinitroanilino)-3-(2,6-dinitrophenyl)sulfanyl-N-(3-methylbutyl)propanamide (PubChem CID 88957986) has the molecular formula C20H22N6O9S and a molecular weight of 522.50 g/mol. Its IUPAC name is 2-(2,6-dinitroanilino)-3-(2,6-dinitrophenyl)sulfanyl-N-(3-methylbutyl)propanamide.
| Compound Name | 2-(2,6-dinitroanilino)-3-(2,6-dinitrophenyl)sulfanyl-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 88957986 |
| Molecular Formula | C20H22N6O9S |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 2-(2,6-dinitroanilino)-3-(2,6-dinitrophenyl)sulfanyl-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)C(CSc1c([N+](=O)[O-])cccc1[N+](=O)[O-])Nc1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N6O9S/c1-12(2)9-10-21-20(27)13(22-18-14(23(28)29)5-3-6-15(18)24(30)31)11-36-19-16(25(32)33)7-4-8-17(19)26(34)35/h3-8,12-13,22H,9-11H2,1-2H3,(H,21,27) |
| InChIKey | KJNMALJFBOQGHA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 213.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|