C43H32N5P — CID 118503370
[3-[6-(3,5-dimethylphenyl)-2-(11-phenylindolo[2,3-a]carbazol-12-yl)pyrimidin-4-yl]-5-methylphenyl]-iminophosphane (PubChem CID 118503370) has the molecular formula C43H32N5P and a molecular weight of 649.74 g/mol. Its IUPAC name is [3-[6-(3,5-dimethylphenyl)-2-(11-phenylindolo[2,3-a]carbazol-12-yl)pyrimidin-4-yl]-5-methylphenyl]-iminophosphane.
| Compound Name | [3-[6-(3,5-dimethylphenyl)-2-(11-phenylindolo[2,3-a]carbazol-12-yl)pyrimidin-4-yl]-5-methylphenyl]-iminophosphane |
|---|---|
| PubChem CID | 118503370 |
| Molecular Formula | C43H32N5P |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 649.24 |
| IUPAC Name | [3-[6-(3,5-dimethylphenyl)-2-(11-phenylindolo[2,3-a]carbazol-12-yl)pyrimidin-4-yl]-5-methylphenyl]-iminophosphane |
| SMILES | [H]/N=P/c1cc(C)cc(-c2cc(-c3cc(C)cc(C)c3)nc(-n3c4ccccc4c4ccc5c6ccccc6n(-c6ccccc6)c5c43)n2)c1 |
| InChI | InChI=1S/C43H32N5P/c1-26-19-27(2)21-29(20-26)37-25-38(30-22-28(3)23-32(24-30)49-44)46-43(45-37)48-40-16-10-8-14-34(40)36-18-17-35-33-13-7-9-15-39(33)47(41(35)42(36)48)31-11-5-4-6-12-31/h4-25,44H,1-3H3 |
| InChIKey | WQDRAHCRAAWADK-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|