C22H22N2O2S — CID 118505462
2-(4-methyl-1,4-diazepan-1-yl)-3-phenylsulfanylnaphthalene-1,4-dione (PubChem CID 118505462) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-(4-methyl-1,4-diazepan-1-yl)-3-phenylsulfanylnaphthalene-1,4-dione.
| Compound Name | 2-(4-methyl-1,4-diazepan-1-yl)-3-phenylsulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 118505462 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-(4-methyl-1,4-diazepan-1-yl)-3-phenylsulfanylnaphthalene-1,4-dione |
| SMILES | CN1CCCN(C2=C(Sc3ccccc3)C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C22H22N2O2S/c1-23-12-7-13-24(15-14-23)19-20(25)17-10-5-6-11-18(17)21(26)22(19)27-16-8-3-2-4-9-16/h2-6,8-11H,7,12-15H2,1H3 |
| InChIKey | LVWRHOGXKSVXKS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|