C20H19N3O2S — CID 118505909
7-(4-methylpiperazin-1-yl)-6-phenylsulfanylisoquinoline-5,8-dione (PubChem CID 118505909) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is 7-(4-methylpiperazin-1-yl)-6-phenylsulfanylisoquinoline-5,8-dione.
| Compound Name | 7-(4-methylpiperazin-1-yl)-6-phenylsulfanylisoquinoline-5,8-dione |
|---|---|
| PubChem CID | 118505909 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 7-(4-methylpiperazin-1-yl)-6-phenylsulfanylisoquinoline-5,8-dione |
| SMILES | CN1CCN(C2=C(Sc3ccccc3)C(=O)c3ccncc3C2=O)CC1 |
| InChI | InChI=1S/C20H19N3O2S/c1-22-9-11-23(12-10-22)17-18(24)16-13-21-8-7-15(16)19(25)20(17)26-14-5-3-2-4-6-14/h2-8,13H,9-12H2,1H3 |
| InChIKey | XPEXOTFSPAZJTM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|