C14H14Cl2N4O2 — CID 52943093
3-chloro-1-(3-chloro-4-pyridinyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 52943093) has the molecular formula C14H14Cl2N4O2 and a molecular weight of 341.20 g/mol. Its IUPAC name is 3-chloro-1-(3-chloro-4-pyridinyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(3-chloro-4-pyridinyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 52943093 |
| Molecular Formula | C14H14Cl2N4O2 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 3-chloro-1-(3-chloro-4-pyridinyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | CN1CCN(C2=C(Cl)C(=O)N(c3ccncc3Cl)C2=O)CC1 |
| InChI | InChI=1S/C14H14Cl2N4O2/c1-18-4-6-19(7-5-18)12-11(16)13(21)20(14(12)22)10-2-3-17-8-9(10)15/h2-3,8H,4-7H2,1H3 |
| InChIKey | WHAYVABKTWFIAA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|