C20H14Cl5N3O2 — CID 16654676
3-chloro-1-(3,4-dichlorophenyl)-4-[4-(3,4-dichlorophenyl)piperazin-1-yl]pyrrole-2,5-dione (PubChem CID 16654676) has the molecular formula C20H14Cl5N3O2 and a molecular weight of 505.62 g/mol. Its IUPAC name is 3-chloro-1-(3,4-dichlorophenyl)-4-[4-(3,4-dichlorophenyl)piperazin-1-yl]pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(3,4-dichlorophenyl)-4-[4-(3,4-dichlorophenyl)piperazin-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 16654676 |
| Molecular Formula | C20H14Cl5N3O2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 502.95 |
| IUPAC Name | 3-chloro-1-(3,4-dichlorophenyl)-4-[4-(3,4-dichlorophenyl)piperazin-1-yl]pyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(N2CCN(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H14Cl5N3O2/c21-13-3-1-11(9-15(13)23)26-5-7-27(8-6-26)18-17(25)19(29)28(20(18)30)12-2-4-14(22)16(24)10-12/h1-4,9-10H,5-8H2 |
| InChIKey | YPWCDLJEMVDZJB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|