C20H24ClN3O4S — CID 11235967
3-chloro-4-piperidin-1-yl-1-(4-piperidin-1-ylsulfonylphenyl)pyrrole-2,5-dione (PubChem CID 11235967) has the molecular formula C20H24ClN3O4S and a molecular weight of 437.95 g/mol. Its IUPAC name is 3-chloro-4-piperidin-1-yl-1-(4-piperidin-1-ylsulfonylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-piperidin-1-yl-1-(4-piperidin-1-ylsulfonylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 11235967 |
| Molecular Formula | C20H24ClN3O4S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 3-chloro-4-piperidin-1-yl-1-(4-piperidin-1-ylsulfonylphenyl)pyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(N2CCCCC2)C(=O)N1c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H24ClN3O4S/c21-17-18(22-11-3-1-4-12-22)20(26)24(19(17)25)15-7-9-16(10-8-15)29(27,28)23-13-5-2-6-14-23/h7-10H,1-6,11-14H2 |
| InChIKey | BRVCWPTVSATIJK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|