C17H14Cl2N6O2 — CID 16654782
3-chloro-1-(6-chloro-3-pyridinyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 16654782) has the molecular formula C17H14Cl2N6O2 and a molecular weight of 405.25 g/mol. Its IUPAC name is 3-chloro-1-(6-chloro-3-pyridinyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(6-chloro-3-pyridinyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 16654782 |
| Molecular Formula | C17H14Cl2N6O2 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 3-chloro-1-(6-chloro-3-pyridinyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(N2CCN(c3ncccn3)CC2)C(=O)N1c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H14Cl2N6O2/c18-12-3-2-11(10-22-12)25-15(26)13(19)14(16(25)27)23-6-8-24(9-7-23)17-20-4-1-5-21-17/h1-5,10H,6-9H2 |
| InChIKey | UEKZVRZTTLOIDM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|