C20H19F4NO4 — CID 118515350
benzyl 2-[[2-fluoro-5-(trifluoromethoxy)benzoyl]amino]-3-methylbutanoate (PubChem CID 118515350) has the molecular formula C20H19F4NO4 and a molecular weight of 413.37 g/mol. Its IUPAC name is benzyl 2-[[2-fluoro-5-(trifluoromethoxy)benzoyl]amino]-3-methylbutanoate.
| Compound Name | benzyl 2-[[2-fluoro-5-(trifluoromethoxy)benzoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 118515350 |
| Molecular Formula | C20H19F4NO4 |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | benzyl 2-[[2-fluoro-5-(trifluoromethoxy)benzoyl]amino]-3-methylbutanoate |
| SMILES | CC(C)C(NC(=O)c1cc(OC(F)(F)F)ccc1F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H19F4NO4/c1-12(2)17(19(27)28-11-13-6-4-3-5-7-13)25-18(26)15-10-14(8-9-16(15)21)29-20(22,23)24/h3-10,12,17H,11H2,1-2H3,(H,25,26) |
| InChIKey | BOPRUEWEMNRBAA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |