C43H25N7O — CID 118517145
4-(9-phenylcarbazol-2-yl)-12-(5-phenyl-[1,2,4]triazino[5,6-b]indol-7-yl)-8-oxa-5,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 118517145) has the molecular formula C43H25N7O and a molecular weight of 655.72 g/mol. Its IUPAC name is 4-(9-phenylcarbazol-2-yl)-12-(5-phenyl-[1,2,4]triazino[5,6-b]indol-7-yl)-8-oxa-5,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 4-(9-phenylcarbazol-2-yl)-12-(5-phenyl-[1,2,4]triazino[5,6-b]indol-7-yl)-8-oxa-5,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 118517145 |
| Molecular Formula | C43H25N7O |
| Molecular Weight | 655.72 g/mol |
| Exact Mass | 655.21 |
| IUPAC Name | 4-(9-phenylcarbazol-2-yl)-12-(5-phenyl-[1,2,4]triazino[5,6-b]indol-7-yl)-8-oxa-5,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | c1ccc(-n2c3ccccc3c3ccc(-c4cc5c(cn4)oc4cnc(-c6ccc7c8nncnc8n(-c8ccccc8)c7c6)cc45)cc32)cc1 |
| InChI | InChI=1S/C43H25N7O/c1-3-9-28(10-4-1)49-37-14-8-7-13-30(37)31-17-15-26(19-38(31)49)35-21-33-34-22-36(45-24-41(34)51-40(33)23-44-35)27-16-18-32-39(20-27)50(29-11-5-2-6-12-29)43-42(32)48-47-25-46-43/h1-25H |
| InChIKey | GCNOWXLAJJMWCZ-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 87.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.72 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |