C24H24F2O4 — CID 118517488
4-[2-[(1R,2R)-2-[(E)-4-(2,3-difluorophenyl)-3-hydroxybut-1-enyl]-5-oxocyclopentyl]ethyl]benzoic acid (PubChem CID 118517488) has the molecular formula C24H24F2O4 and a molecular weight of 414.45 g/mol. Its IUPAC name is 4-[2-[(1R,2R)-2-[(E)-4-(2,3-difluorophenyl)-3-hydroxybut-1-enyl]-5-oxocyclopentyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(1R,2R)-2-[(E)-4-(2,3-difluorophenyl)-3-hydroxybut-1-enyl]-5-oxocyclopentyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 118517488 |
| Molecular Formula | C24H24F2O4 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 4-[2-[(1R,2R)-2-[(E)-4-(2,3-difluorophenyl)-3-hydroxybut-1-enyl]-5-oxocyclopentyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC[C@H]2C(=O)CC[C@@H]2/C=C/C(O)Cc2cccc(F)c2F)cc1 |
| InChI | InChI=1S/C24H24F2O4/c25-21-3-1-2-18(23(21)26)14-19(27)11-9-16-10-13-22(28)20(16)12-6-15-4-7-17(8-5-15)24(29)30/h1-5,7-9,11,16,19-20,27H,6,10,12-14H2,(H,29,30)/b11-9+/t16-,19?,20+/m0/s1 |
| InChIKey | ZHIYYJVFRSDGIT-SATSMNEMSA-N |
| XLogP | 4.35 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|