About 4-(3,5-difluorophenyl)benzoic acid
4-(3,5-difluorophenyl)benzoic acid (PubChem CID 5288193) has the molecular formula C13H8F2O2
and a molecular weight of 234.20 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)benzoic acid.
Molecular Properties
| Compound Name | 4-(3,5-difluorophenyl)benzoic acid |
| PubChem CID | 5288193 |
| Molecular Formula | C13H8F2O2 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 4-(3,5-difluorophenyl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C13H8F2O2/c14-11-5-10(6-12(15)7-11)8-1-3-9(4-2-8)13(16)17/h1-7H,(H,16,17) |
| InChIKey | VCEFNMHMLWBFNV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3,5-difluorophenyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-difluorophenyl)benzoic acid?
The IUPAC name of 4-(3,5-difluorophenyl)benzoic acid (CID 5288193) is 4-(3,5-difluorophenyl)benzoic acid.
What is the SMILES notation for 4-(3,5-difluorophenyl)benzoic acid?
The canonical SMILES for 4-(3,5-difluorophenyl)benzoic acid is O=C(O)c1ccc(-c2cc(F)cc(F)c2)cc1.
What is the InChIKey of 4-(3,5-difluorophenyl)benzoic acid?
The InChIKey is VCEFNMHMLWBFNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F2O2/c14-11-5-10(6-12(15)7-11)8-1-3-9(4-2-8)13(16)17/h1-7H,(H,16,17).
What are the key properties of 4-(3,5-difluorophenyl)benzoic acid?
4-(3,5-difluorophenyl)benzoic acid has a molecular weight of 234.20 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-difluorophenyl)benzoic acid is sourced from PubChem (CID 5288193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).