About 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one
2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one (PubChem CID 118517941) has the molecular formula C17H12F3N5O
and a molecular weight of 359.31 g/mol. Its IUPAC name is 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one.
Molecular Properties
| Compound Name | 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one |
| PubChem CID | 118517941 |
| Molecular Formula | C17H12F3N5O |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one |
| SMILES | O=C1c2cn(-c3cccnc3)nc2CCN1c1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F3N5O/c18-17(19,20)15-8-11(3-6-22-15)24-7-4-14-13(16(24)26)10-25(23-14)12-2-1-5-21-9-12/h1-3,5-6,8-10H,4,7H2 |
| InChIKey | IRHSEQHCFJXHED-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one?
The IUPAC name of 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one (CID 118517941) is 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one.
What is the SMILES notation for 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one?
The canonical SMILES for 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one is O=C1c2cn(-c3cccnc3)nc2CCN1c1ccnc(C(F)(F)F)c1.
What is the InChIKey of 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one?
The InChIKey is IRHSEQHCFJXHED-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F3N5O/c18-17(19,20)15-8-11(3-6-22-15)24-7-4-14-13(16(24)26)10-25(23-14)12-2-1-5-21-9-12/h1-3,5-6,8-10H,4,7H2.
What are the key properties of 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one?
2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one has a molecular weight of 359.31 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-yl-5-[2-(trifluoromethyl)-4-pyridinyl]-6,7-dihydropyrazolo[4,3-c]pyridin-4-one is sourced from PubChem (CID 118517941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).