C10H9F3N2O — CID 166609012
1-[2-(trifluoromethyl)-4-pyridinyl]pyrrolidin-2-one (PubChem CID 166609012) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-4-pyridinyl]pyrrolidin-2-one.
| Compound Name | 1-[2-(trifluoromethyl)-4-pyridinyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 166609012 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-[2-(trifluoromethyl)-4-pyridinyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3N2O/c11-10(12,13)8-6-7(3-4-14-8)15-5-1-2-9(15)16/h3-4,6H,1-2,5H2 |
| InChIKey | LVOMRXGTRJVLIR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |