C15H11F3N6O — CID 139028746
3-[3-oxo-4-[2-(trifluoromethyl)-4-pyridinyl]piperazin-1-yl]pyrazine-2-carbonitrile (PubChem CID 139028746) has the molecular formula C15H11F3N6O and a molecular weight of 348.29 g/mol. Its IUPAC name is 3-[3-oxo-4-[2-(trifluoromethyl)-4-pyridinyl]piperazin-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[3-oxo-4-[2-(trifluoromethyl)-4-pyridinyl]piperazin-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 139028746 |
| Molecular Formula | C15H11F3N6O |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 3-[3-oxo-4-[2-(trifluoromethyl)-4-pyridinyl]piperazin-1-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CCN(c2ccnc(C(F)(F)F)c2)C(=O)C1 |
| InChI | InChI=1S/C15H11F3N6O/c16-15(17,18)12-7-10(1-2-21-12)24-6-5-23(9-13(24)25)14-11(8-19)20-3-4-22-14/h1-4,7H,5-6,9H2 |
| InChIKey | XNWMPOFJNCVEDN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 86.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |