C17H20N2O7S — CID 118519573
1-[(3R,3aS)-1-oxo-7-(2-oxopiperidin-1-yl)-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]ethanesulfonic acid (PubChem CID 118519573) has the molecular formula C17H20N2O7S and a molecular weight of 396.42 g/mol. Its IUPAC name is 1-[(3R,3aS)-1-oxo-7-(2-oxopiperidin-1-yl)-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]ethanesulfonic acid.
| Compound Name | 1-[(3R,3aS)-1-oxo-7-(2-oxopiperidin-1-yl)-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 118519573 |
| Molecular Formula | C17H20N2O7S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-[(3R,3aS)-1-oxo-7-(2-oxopiperidin-1-yl)-3a,4-dihydro-3H-[1,3]oxazolo[4,3-c][1,4]benzoxazin-3-yl]ethanesulfonic acid |
| SMILES | CC([C@@H]1OC(=O)N2c3ccc(N4CCCCC4=O)cc3OC[C@@H]12)S(=O)(=O)O |
| InChI | InChI=1S/C17H20N2O7S/c1-10(27(22,23)24)16-13-9-25-14-8-11(18-7-3-2-4-15(18)20)5-6-12(14)19(13)17(21)26-16/h5-6,8,10,13,16H,2-4,7,9H2,1H3,(H,22,23,24)/t10?,13-,16-/m0/s1 |
| InChIKey | TVJXCMRVJJKZGK-WIXVZTRSSA-N |
| XLogP | 1.57 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|