C18H19Br — CID 118526484
6-(bromomethyl)-3,3-dimethyl-1-phenyl-1,2-dihydroindene (PubChem CID 118526484) has the molecular formula C18H19Br and a molecular weight of 315.25 g/mol. Its IUPAC name is 6-(bromomethyl)-3,3-dimethyl-1-phenyl-1,2-dihydroindene.
| Compound Name | 6-(bromomethyl)-3,3-dimethyl-1-phenyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 118526484 |
| Molecular Formula | C18H19Br |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 6-(bromomethyl)-3,3-dimethyl-1-phenyl-1,2-dihydroindene |
| SMILES | CC1(C)CC(c2ccccc2)c2cc(CBr)ccc21 |
| InChI | InChI=1S/C18H19Br/c1-18(2)11-16(14-6-4-3-5-7-14)15-10-13(12-19)8-9-17(15)18/h3-10,16H,11-12H2,1-2H3 |
| InChIKey | XKXQBUPTCYVVIB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|