C14H17N3O — CID 118526772
N-(4-phenylbutyl)pyrazole-1-carboxamide (PubChem CID 118526772) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is N-(4-phenylbutyl)pyrazole-1-carboxamide.
| Compound Name | N-(4-phenylbutyl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 118526772 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-(4-phenylbutyl)pyrazole-1-carboxamide |
| SMILES | O=C(NCCCCc1ccccc1)n1cccn1 |
| InChI | InChI=1S/C14H17N3O/c18-14(17-12-6-11-16-17)15-10-5-4-9-13-7-2-1-3-8-13/h1-3,6-8,11-12H,4-5,9-10H2,(H,15,18) |
| InChIKey | UJHDXVGWUYNVSD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|