C13H15N3O — CID 118526757
N-(3-phenylpropyl)pyrazole-1-carboxamide (PubChem CID 118526757) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is N-(3-phenylpropyl)pyrazole-1-carboxamide.
| Compound Name | N-(3-phenylpropyl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 118526757 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N-(3-phenylpropyl)pyrazole-1-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)n1cccn1 |
| InChI | InChI=1S/C13H15N3O/c17-13(16-11-5-10-15-16)14-9-4-8-12-6-2-1-3-7-12/h1-3,5-7,10-11H,4,8-9H2,(H,14,17) |
| InChIKey | JXKJGTZJXLBVCZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|