C9H17NO4 — CID 118527120
N-(5-ethyl-3,4-dihydroxyoxolan-2-yl)-N-methylacetamide (PubChem CID 118527120) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is N-(5-ethyl-3,4-dihydroxyoxolan-2-yl)-N-methylacetamide.
| Compound Name | N-(5-ethyl-3,4-dihydroxyoxolan-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 118527120 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N-(5-ethyl-3,4-dihydroxyoxolan-2-yl)-N-methylacetamide |
| SMILES | CCC1OC(N(C)C(C)=O)C(O)C1O |
| InChI | InChI=1S/C9H17NO4/c1-4-6-7(12)8(13)9(14-6)10(3)5(2)11/h6-9,12-13H,4H2,1-3H3 |
| InChIKey | ZGLVOVAGTDCDGX-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |