C15H20F3N3O — CID 118527457
3-ethyl-5-piperazin-1-yl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 118527457) has the molecular formula C15H20F3N3O and a molecular weight of 315.34 g/mol. Its IUPAC name is 3-ethyl-5-piperazin-1-yl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-ethyl-5-piperazin-1-yl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 118527457 |
| Molecular Formula | C15H20F3N3O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-ethyl-5-piperazin-1-yl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCc1cc(C(=O)NCC(F)(F)F)cc(N2CCNCC2)c1 |
| InChI | InChI=1S/C15H20F3N3O/c1-2-11-7-12(14(22)20-10-15(16,17)18)9-13(8-11)21-5-3-19-4-6-21/h7-9,19H,2-6,10H2,1H3,(H,20,22) |
| InChIKey | QIMLEJRDYKGBBK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |