C22H27ClF3N3O3S — CID 162563326
N-[(2Z,4Z)-6-chloro-3-ethylsulfonyl-2-methylhepta-2,4,6-trienyl]-3-piperazin-1-yl-5-(trifluoromethyl)benzamide (PubChem CID 162563326) has the molecular formula C22H27ClF3N3O3S and a molecular weight of 505.99 g/mol. Its IUPAC name is N-[(2Z,4Z)-6-chloro-3-ethylsulfonyl-2-methylhepta-2,4,6-trienyl]-3-piperazin-1-yl-5-(trifluoromethyl)benzamide.
| Compound Name | N-[(2Z,4Z)-6-chloro-3-ethylsulfonyl-2-methylhepta-2,4,6-trienyl]-3-piperazin-1-yl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 162563326 |
| Molecular Formula | C22H27ClF3N3O3S |
| Molecular Weight | 505.99 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | N-[(2Z,4Z)-6-chloro-3-ethylsulfonyl-2-methylhepta-2,4,6-trienyl]-3-piperazin-1-yl-5-(trifluoromethyl)benzamide |
| SMILES | C=C(Cl)/C=C\C(=C(/C)CNC(=O)c1cc(N2CCNCC2)cc(C(F)(F)F)c1)S(=O)(=O)CC |
| InChI | InChI=1S/C22H27ClF3N3O3S/c1-4-33(31,32)20(6-5-16(3)23)15(2)14-28-21(30)17-11-18(22(24,25)26)13-19(12-17)29-9-7-27-8-10-29/h5-6,11-13,27H,3-4,7-10,14H2,1-2H3,(H,28,30)/b6-5-,20-15- |
| InChIKey | YHFDRFMKTCAPGO-IFXDYBPZSA-N |
| XLogP | 3.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.99 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|