C19H20F3N3OS — CID 123536467
3-methylsulfanyl-5-piperazin-1-yl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 123536467) has the molecular formula C19H20F3N3OS and a molecular weight of 395.45 g/mol. Its IUPAC name is 3-methylsulfanyl-5-piperazin-1-yl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-methylsulfanyl-5-piperazin-1-yl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 123536467 |
| Molecular Formula | C19H20F3N3OS |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-methylsulfanyl-5-piperazin-1-yl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CSc1cc(C(=O)Nc2cccc(C(F)(F)F)c2)cc(N2CCNCC2)c1 |
| InChI | InChI=1S/C19H20F3N3OS/c1-27-17-10-13(9-16(12-17)25-7-5-23-6-8-25)18(26)24-15-4-2-3-14(11-15)19(20,21)22/h2-4,9-12,23H,5-8H2,1H3,(H,24,26) |
| InChIKey | AMGWVFGICHQVBM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |