C21H34F3N5OSi — CID 20728654
4-[[dimethyl-[3-piperazin-1-yl-5-(trifluoromethyl)phenyl]silyl]methyl]-N-ethylpiperazine-1-carboxamide (PubChem CID 20728654) has the molecular formula C21H34F3N5OSi and a molecular weight of 457.62 g/mol. Its IUPAC name is 4-[[dimethyl-[3-piperazin-1-yl-5-(trifluoromethyl)phenyl]silyl]methyl]-N-ethylpiperazine-1-carboxamide.
| Compound Name | 4-[[dimethyl-[3-piperazin-1-yl-5-(trifluoromethyl)phenyl]silyl]methyl]-N-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 20728654 |
| Molecular Formula | C21H34F3N5OSi |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 4-[[dimethyl-[3-piperazin-1-yl-5-(trifluoromethyl)phenyl]silyl]methyl]-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(C[Si](C)(C)c2cc(N3CCNCC3)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H34F3N5OSi/c1-4-26-20(30)29-11-9-27(10-12-29)16-31(2,3)19-14-17(21(22,23)24)13-18(15-19)28-7-5-25-6-8-28/h13-15,25H,4-12,16H2,1-3H3,(H,26,30) |
| InChIKey | FOJFBKLAMXUOAC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|