C32H48N6 — CID 118529411
5-(4-pentylcyclohexyl)-3-[3-[5-(4-pentylcyclohexyl)-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazole (PubChem CID 118529411) has the molecular formula C32H48N6 and a molecular weight of 516.78 g/mol. Its IUPAC name is 5-(4-pentylcyclohexyl)-3-[3-[5-(4-pentylcyclohexyl)-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazole.
| Compound Name | 5-(4-pentylcyclohexyl)-3-[3-[5-(4-pentylcyclohexyl)-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 118529411 |
| Molecular Formula | C32H48N6 |
| Molecular Weight | 516.78 g/mol |
| Exact Mass | 516.39 |
| IUPAC Name | 5-(4-pentylcyclohexyl)-3-[3-[5-(4-pentylcyclohexyl)-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazole |
| SMILES | CCCCCC1CCC(c2nc(-c3cccc(-c4n[nH]c(C5CCC(CCCCC)CC5)n4)c3)n[nH]2)CC1 |
| InChI | InChI=1S/C32H48N6/c1-3-5-7-10-23-14-18-25(19-15-23)29-33-31(37-35-29)27-12-9-13-28(22-27)32-34-30(36-38-32)26-20-16-24(17-21-26)11-8-6-4-2/h9,12-13,22-26H,3-8,10-11,14-21H2,1-2H3,(H,33,35,37)(H,34,36,38) |
| InChIKey | IPLBWRSBFKXWSM-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.78 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|