C15H25N3 — CID 61338878
5-(4-butylcyclohexyl)-3-cyclopropyl-1H-1,2,4-triazole (PubChem CID 61338878) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 5-(4-butylcyclohexyl)-3-cyclopropyl-1H-1,2,4-triazole.
| Compound Name | 5-(4-butylcyclohexyl)-3-cyclopropyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 61338878 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 5-(4-butylcyclohexyl)-3-cyclopropyl-1H-1,2,4-triazole |
| SMILES | CCCCC1CCC(c2nc(C3CC3)n[nH]2)CC1 |
| InChI | InChI=1S/C15H25N3/c1-2-3-4-11-5-7-12(8-6-11)14-16-15(18-17-14)13-9-10-13/h11-13H,2-10H2,1H3,(H,16,17,18) |
| InChIKey | MVZBHMYAOARACL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |