C13H22N2OS — CID 2763330
5-(4-pentylcyclohexyl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 2763330) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 5-(4-pentylcyclohexyl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(4-pentylcyclohexyl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 2763330 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 5-(4-pentylcyclohexyl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CCCCCC1CCC(c2n[nH]c(=S)o2)CC1 |
| InChI | InChI=1S/C13H22N2OS/c1-2-3-4-5-10-6-8-11(9-7-10)12-14-15-13(17)16-12/h10-11H,2-9H2,1H3,(H,15,17) |
| InChIKey | HWQQUVXVUDIVHG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|