C10H16ClN3 — CID 65390752
3-chloro-5-(4-ethylcyclohexyl)-1H-1,2,4-triazole (PubChem CID 65390752) has the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. Its IUPAC name is 3-chloro-5-(4-ethylcyclohexyl)-1H-1,2,4-triazole.
| Compound Name | 3-chloro-5-(4-ethylcyclohexyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 65390752 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-chloro-5-(4-ethylcyclohexyl)-1H-1,2,4-triazole |
| SMILES | CCC1CCC(c2nc(Cl)n[nH]2)CC1 |
| InChI | InChI=1S/C10H16ClN3/c1-2-7-3-5-8(6-4-7)9-12-10(11)14-13-9/h7-8H,2-6H2,1H3,(H,12,13,14) |
| InChIKey | NISDJEQYVYNAEC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |