C7H11ClN4 — CID 84660806
3-(3-chloro-1H-1,2,4-triazol-5-yl)piperidine (PubChem CID 84660806) has the molecular formula C7H11ClN4 and a molecular weight of 186.65 g/mol. Its IUPAC name is 3-(3-chloro-1H-1,2,4-triazol-5-yl)piperidine.
| Compound Name | 3-(3-chloro-1H-1,2,4-triazol-5-yl)piperidine |
|---|---|
| PubChem CID | 84660806 |
| Molecular Formula | C7H11ClN4 |
| Molecular Weight | 186.65 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 3-(3-chloro-1H-1,2,4-triazol-5-yl)piperidine |
| SMILES | Clc1n[nH]c(C2CCCNC2)n1 |
| InChI | InChI=1S/C7H11ClN4/c8-7-10-6(11-12-7)5-2-1-3-9-4-5/h5,9H,1-4H2,(H,10,11,12) |
| InChIKey | CKVHKFMBDHHAEF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.65 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |