C16H28N4 — CID 83200320
3-[2-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)propan-2-yl]piperidine (PubChem CID 83200320) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is 3-[2-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)propan-2-yl]piperidine.
| Compound Name | 3-[2-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)propan-2-yl]piperidine |
|---|---|
| PubChem CID | 83200320 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 3-[2-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)propan-2-yl]piperidine |
| SMILES | CC(C)(c1n[nH]c(C2CCCCC2)n1)C1CCCNC1 |
| InChI | InChI=1S/C16H28N4/c1-16(2,13-9-6-10-17-11-13)15-18-14(19-20-15)12-7-4-3-5-8-12/h12-13,17H,3-11H2,1-2H3,(H,18,19,20) |
| InChIKey | GVQHRNZUSSKOBE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |