C8H11Cl3N4 — CID 82569188
3-[3-(trichloromethyl)-1H-1,2,4-triazol-5-yl]piperidine (PubChem CID 82569188) has the molecular formula C8H11Cl3N4 and a molecular weight of 269.56 g/mol. Its IUPAC name is 3-[3-(trichloromethyl)-1H-1,2,4-triazol-5-yl]piperidine.
| Compound Name | 3-[3-(trichloromethyl)-1H-1,2,4-triazol-5-yl]piperidine |
|---|---|
| PubChem CID | 82569188 |
| Molecular Formula | C8H11Cl3N4 |
| Molecular Weight | 269.56 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 3-[3-(trichloromethyl)-1H-1,2,4-triazol-5-yl]piperidine |
| SMILES | ClC(Cl)(Cl)c1n[nH]c(C2CCCNC2)n1 |
| InChI | InChI=1S/C8H11Cl3N4/c9-8(10,11)7-13-6(14-15-7)5-2-1-3-12-4-5/h5,12H,1-4H2,(H,13,14,15) |
| InChIKey | HOHJUGZDNHKHPX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.56 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|