C13H15ClN4 — CID 82569184
3-[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]piperidine (PubChem CID 82569184) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]piperidine.
| Compound Name | 3-[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]piperidine |
|---|---|
| PubChem CID | 82569184 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]piperidine |
| SMILES | Clc1ccc(-c2n[nH]c(C3CCCNC3)n2)cc1 |
| InChI | InChI=1S/C13H15ClN4/c14-11-5-3-9(4-6-11)12-16-13(18-17-12)10-2-1-7-15-8-10/h3-6,10,15H,1-2,7-8H2,(H,16,17,18) |
| InChIKey | MEXLARQDDYMRMN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |