C12H14ClN5 — CID 67027843
5-chloro-2-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine (PubChem CID 67027843) has the molecular formula C12H14ClN5 and a molecular weight of 263.73 g/mol. Its IUPAC name is 5-chloro-2-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine.
| Compound Name | 5-chloro-2-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine |
|---|---|
| PubChem CID | 67027843 |
| Molecular Formula | C12H14ClN5 |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-chloro-2-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine |
| SMILES | Clc1ccc(-c2n[nH]c(C3CCNCC3)n2)nc1 |
| InChI | InChI=1S/C12H14ClN5/c13-9-1-2-10(15-7-9)12-16-11(17-18-12)8-3-5-14-6-4-8/h1-2,7-8,14H,3-6H2,(H,16,17,18) |
| InChIKey | XRBZVTMWPCTMMZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |