C14H19N5 — CID 68755908
4-ethyl-2-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine (PubChem CID 68755908) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 4-ethyl-2-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine.
| Compound Name | 4-ethyl-2-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine |
|---|---|
| PubChem CID | 68755908 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 4-ethyl-2-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine |
| SMILES | CCc1ccnc(-c2n[nH]c(C3CCNCC3)n2)c1 |
| InChI | InChI=1S/C14H19N5/c1-2-10-3-8-16-12(9-10)14-17-13(18-19-14)11-4-6-15-7-5-11/h3,8-9,11,15H,2,4-7H2,1H3,(H,17,18,19) |
| InChIKey | XSZXBQUTDKTUAW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |