C12H14BrN5 — CID 82569112
3-bromo-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine (PubChem CID 82569112) has the molecular formula C12H14BrN5 and a molecular weight of 308.18 g/mol. Its IUPAC name is 3-bromo-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine.
| Compound Name | 3-bromo-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine |
|---|---|
| PubChem CID | 82569112 |
| Molecular Formula | C12H14BrN5 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 3-bromo-5-(5-piperidin-4-yl-1H-1,2,4-triazol-3-yl)pyridine |
| SMILES | Brc1cncc(-c2n[nH]c(C3CCNCC3)n2)c1 |
| InChI | InChI=1S/C12H14BrN5/c13-10-5-9(6-15-7-10)12-16-11(17-18-12)8-1-3-14-4-2-8/h5-8,14H,1-4H2,(H,16,17,18) |
| InChIKey | PUWCKQMCNHQVJX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |