C7H12N4 — CID 57004215
3-(1H-1,2,4-triazol-5-yl)piperidine (PubChem CID 57004215) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-(1H-1,2,4-triazol-5-yl)piperidine.
| Compound Name | 3-(1H-1,2,4-triazol-5-yl)piperidine |
|---|---|
| PubChem CID | 57004215 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 3-(1H-1,2,4-triazol-5-yl)piperidine |
| SMILES | c1n[nH]c(C2CCCNC2)n1 |
| InChI | InChI=1S/C7H12N4/c1-2-6(4-8-3-1)7-9-5-10-11-7/h5-6,8H,1-4H2,(H,9,10,11) |
| InChIKey | IZHAMQUVVWJULL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |